C9H8F3NO6S2 — CID 167078246
[4-(oxiran-2-yl)phenyl] N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 167078246) has the molecular formula C9H8F3NO6S2 and a molecular weight of 347.29 g/mol. Its IUPAC name is [4-(oxiran-2-yl)phenyl] N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | [4-(oxiran-2-yl)phenyl] N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 167078246 |
| Molecular Formula | C9H8F3NO6S2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | [4-(oxiran-2-yl)phenyl] N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)Oc1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C9H8F3NO6S2/c10-9(11,12)20(14,15)13-21(16,17)19-7-3-1-6(2-4-7)8-5-18-8/h1-4,8,13H,5H2 |
| InChIKey | VJBMHHJNJCWGEY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|