C14H13F3NO5S3+ — CID 140753311
methyl-phenyl-[4-(trifluoromethylsulfonylsulfamoyloxy)phenyl]sulfanium (PubChem CID 140753311) has the molecular formula C14H13F3NO5S3+ and a molecular weight of 428.46 g/mol. Its IUPAC name is methyl-phenyl-[4-(trifluoromethylsulfonylsulfamoyloxy)phenyl]sulfanium.
| Compound Name | methyl-phenyl-[4-(trifluoromethylsulfonylsulfamoyloxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 140753311 |
| Molecular Formula | C14H13F3NO5S3+ |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | methyl-phenyl-[4-(trifluoromethylsulfonylsulfamoyloxy)phenyl]sulfanium |
| SMILES | C[S+](c1ccccc1)c1ccc(OS(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3NO5S3/c1-24(12-5-3-2-4-6-12)13-9-7-11(8-10-13)23-26(21,22)18-25(19,20)14(15,16)17/h2-10,18H,1H3/q+1 |
| InChIKey | HCFGNDPVEIVDNH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|