C17H23F3NO7S3+ — CID 140753259
[4-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]phenyl] N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 140753259) has the molecular formula C17H23F3NO7S3+ and a molecular weight of 506.57 g/mol. Its IUPAC name is [4-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]phenyl] N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | [4-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]phenyl] N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 140753259 |
| Molecular Formula | C17H23F3NO7S3+ |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [4-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]phenyl] N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | CC(C)(C)C(C(=O)c1ccc(OS(=O)(=O)NS(=O)(=O)C(F)(F)F)cc1)[S+]1CCOCC1 |
| InChI | InChI=1S/C17H23F3NO7S3/c1-16(2,3)15(29-10-8-27-9-11-29)14(22)12-4-6-13(7-5-12)28-31(25,26)21-30(23,24)17(18,19)20/h4-7,15,21H,8-11H2,1-3H3/q+1 |
| InChIKey | BLGUORRNYMHRPY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|