C19H29O3S+ — CID 140741743
3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)butan-1-one (PubChem CID 140741743) has the molecular formula C19H29O3S+ and a molecular weight of 337.51 g/mol. Its IUPAC name is 3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)butan-1-one.
| Compound Name | 3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
|---|---|
| PubChem CID | 140741743 |
| Molecular Formula | C19H29O3S+ |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-methyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
| SMILES | CC(C)C(C(=O)c1ccc(OC(C)(C)C)cc1)[S+]1CCOCC1 |
| InChI | InChI=1S/C19H29O3S/c1-14(2)18(23-12-10-21-11-13-23)17(20)15-6-8-16(9-7-15)22-19(3,4)5/h6-9,14,18H,10-13H2,1-5H3/q+1 |
| InChIKey | FEHPBJZYOZNOII-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|