C14H21O2S+ — CID 140816185
4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,4-oxathian-4-ium (PubChem CID 140816185) has the molecular formula C14H21O2S+ and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,4-oxathian-4-ium.
| Compound Name | 4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 140816185 |
| Molecular Formula | C14H21O2S+ |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,4-oxathian-4-ium |
| SMILES | CC(C)(C)Oc1ccc([S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C14H21O2S/c1-14(2,3)16-12-4-6-13(7-5-12)17-10-8-15-9-11-17/h4-7H,8-11H2,1-3H3/q+1 |
| InChIKey | LTXKFFXDMVYWRM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|