C16H23O3S+ — CID 140775113
[4-(1,4-oxathian-4-ium-4-yl)phenyl] 2,2-dimethylbutanoate (PubChem CID 140775113) has the molecular formula C16H23O3S+ and a molecular weight of 295.42 g/mol. Its IUPAC name is [4-(1,4-oxathian-4-ium-4-yl)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-(1,4-oxathian-4-ium-4-yl)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140775113 |
| Molecular Formula | C16H23O3S+ |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-(1,4-oxathian-4-ium-4-yl)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc([S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C16H23O3S/c1-4-16(2,3)15(17)19-13-5-7-14(8-6-13)20-11-9-18-10-12-20/h5-8H,4,9-12H2,1-3H3/q+1 |
| InChIKey | AQXBIOMLDCBQDZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|