C37H54O6S2+2 — CID 163952108
bis[4-(1,4-oxathian-4-ium-4-yl)phenyl] 2-(2,2-dimethylpropyl)-2,3,3,7-tetramethyloctanedioate (PubChem CID 163952108) has the molecular formula C37H54O6S2+2 and a molecular weight of 658.97 g/mol. Its IUPAC name is bis[4-(1,4-oxathian-4-ium-4-yl)phenyl] 2-(2,2-dimethylpropyl)-2,3,3,7-tetramethyloctanedioate.
| Compound Name | bis[4-(1,4-oxathian-4-ium-4-yl)phenyl] 2-(2,2-dimethylpropyl)-2,3,3,7-tetramethyloctanedioate |
|---|---|
| PubChem CID | 163952108 |
| Molecular Formula | C37H54O6S2+2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | bis[4-(1,4-oxathian-4-ium-4-yl)phenyl] 2-(2,2-dimethylpropyl)-2,3,3,7-tetramethyloctanedioate |
| SMILES | CC(CCCC(C)(C)C(C)(CC(C)(C)C)C(=O)Oc1ccc([S+]2CCOCC2)cc1)C(=O)Oc1ccc([S+]2CCOCC2)cc1 |
| InChI | InChI=1S/C37H54O6S2/c1-28(33(38)42-29-10-14-31(15-11-29)44-23-19-40-20-24-44)9-8-18-36(5,6)37(7,27-35(2,3)4)34(39)43-30-12-16-32(17-13-30)45-25-21-41-22-26-45/h10-17,28H,8-9,18-27H2,1-7H3/q+2 |
| InChIKey | SAFMZNHQAUNXIX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|