C22H27O2S2+ — CID 140741740
3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(4-phenylsulfanylphenyl)butan-1-one (PubChem CID 140741740) has the molecular formula C22H27O2S2+ and a molecular weight of 387.59 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(4-phenylsulfanylphenyl)butan-1-one.
| Compound Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(4-phenylsulfanylphenyl)butan-1-one |
|---|---|
| PubChem CID | 140741740 |
| Molecular Formula | C22H27O2S2+ |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(4-phenylsulfanylphenyl)butan-1-one |
| SMILES | CC(C)(C)C(C(=O)c1ccc(Sc2ccccc2)cc1)[S+]1CCOCC1 |
| InChI | InChI=1S/C22H27O2S2/c1-22(2,3)21(26-15-13-24-14-16-26)20(23)17-9-11-19(12-10-17)25-18-7-5-4-6-8-18/h4-12,21H,13-16H2,1-3H3/q+1 |
| InChIKey | LMVUWZPBONSZPQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|