C23H25O4S+ — CID 140692067
2-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]xanthen-9-one (PubChem CID 140692067) has the molecular formula C23H25O4S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]xanthen-9-one.
| Compound Name | 2-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]xanthen-9-one |
|---|---|
| PubChem CID | 140692067 |
| Molecular Formula | C23H25O4S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butanoyl]xanthen-9-one |
| SMILES | CC(C)(C)C(C(=O)c1ccc2oc3ccccc3c(=O)c2c1)[S+]1CCOCC1 |
| InChI | InChI=1S/C23H25O4S/c1-23(2,3)22(28-12-10-26-11-13-28)20(24)15-8-9-19-17(14-15)21(25)16-6-4-5-7-18(16)27-19/h4-9,14,22H,10-13H2,1-3H3/q+1 |
| InChIKey | BGFDBZIOFPBGSH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|