C23H26O4S — CID 118406364
2-[2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutanoyl]xanthen-9-one (PubChem CID 118406364) has the molecular formula C23H26O4S and a molecular weight of 398.52 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutanoyl]xanthen-9-one.
| Compound Name | 2-[2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutanoyl]xanthen-9-one |
|---|---|
| PubChem CID | 118406364 |
| Molecular Formula | C23H26O4S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[2-(2-ethoxyethylsulfanyl)-3,3-dimethylbutanoyl]xanthen-9-one |
| SMILES | CCOCCSC(C(=O)c1ccc2oc3ccccc3c(=O)c2c1)C(C)(C)C |
| InChI | InChI=1S/C23H26O4S/c1-5-26-12-13-28-22(23(2,3)4)20(24)15-10-11-19-17(14-15)21(25)16-8-6-7-9-18(16)27-19/h6-11,14,22H,5,12-13H2,1-4H3 |
| InChIKey | ZTOIDSKALPEVKU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|