About ethyl propanoate;3-hydroxyxanthen-9-one
ethyl propanoate;3-hydroxyxanthen-9-one (PubChem CID 174285230) has the molecular formula C18H18O5
and a molecular weight of 314.34 g/mol. Its IUPAC name is ethyl propanoate;3-hydroxyxanthen-9-one.
Molecular Properties
| Compound Name | ethyl propanoate;3-hydroxyxanthen-9-one |
| PubChem CID | 174285230 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | ethyl propanoate;3-hydroxyxanthen-9-one |
| SMILES | CCOC(=O)CC.O=c1c2ccccc2oc2cc(O)ccc12 |
| InChI | InChI=1S/C13H8O3.C5H10O2/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15;1-3-5(6)7-4-2/h1-7,14H;3-4H2,1-2H3 |
| InChIKey | BUCLMMHETXPEAD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl propanoate;3-hydroxyxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl propanoate;3-hydroxyxanthen-9-one?
The IUPAC name of ethyl propanoate;3-hydroxyxanthen-9-one (CID 174285230) is ethyl propanoate;3-hydroxyxanthen-9-one.
What is the SMILES notation for ethyl propanoate;3-hydroxyxanthen-9-one?
The canonical SMILES for ethyl propanoate;3-hydroxyxanthen-9-one is CCOC(=O)CC.O=c1c2ccccc2oc2cc(O)ccc12.
What is the InChIKey of ethyl propanoate;3-hydroxyxanthen-9-one?
The InChIKey is BUCLMMHETXPEAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O3.C5H10O2/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15;1-3-5(6)7-4-2/h1-7,14H;3-4H2,1-2H3.
What are the key properties of ethyl propanoate;3-hydroxyxanthen-9-one?
ethyl propanoate;3-hydroxyxanthen-9-one has a molecular weight of 314.34 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl propanoate;3-hydroxyxanthen-9-one is sourced from PubChem (CID 174285230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).