C24H28O4S — CID 144658333
2-[3,3-dimethyl-2-(4-methyl-1,4-oxathian-4-yl)butanoyl]xanthen-9-one (PubChem CID 144658333) has the molecular formula C24H28O4S and a molecular weight of 412.55 g/mol. Its IUPAC name is 2-[3,3-dimethyl-2-(4-methyl-1,4-oxathian-4-yl)butanoyl]xanthen-9-one.
| Compound Name | 2-[3,3-dimethyl-2-(4-methyl-1,4-oxathian-4-yl)butanoyl]xanthen-9-one |
|---|---|
| PubChem CID | 144658333 |
| Molecular Formula | C24H28O4S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[3,3-dimethyl-2-(4-methyl-1,4-oxathian-4-yl)butanoyl]xanthen-9-one |
| SMILES | CC(C)(C)C(C(=O)c1ccc2oc3ccccc3c(=O)c2c1)S1(C)CCOCC1 |
| InChI | InChI=1S/C24H28O4S/c1-24(2,3)23(29(4)13-11-27-12-14-29)21(25)16-9-10-20-18(15-16)22(26)17-7-5-6-8-19(17)28-20/h5-10,15,23H,11-14H2,1-4H3 |
| InChIKey | FDYHBTJFZBDUHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|