C17H14O4 — CID 62799394
dibenzofuran-2-yl(1,4-dioxan-2-yl)methanone (PubChem CID 62799394) has the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is dibenzofuran-2-yl(1,4-dioxan-2-yl)methanone.
| Compound Name | dibenzofuran-2-yl(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 62799394 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | dibenzofuran-2-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(c1ccc2oc3ccccc3c2c1)C1COCCO1 |
| InChI | InChI=1S/C17H14O4/c18-17(16-10-19-7-8-20-16)11-5-6-15-13(9-11)12-3-1-2-4-14(12)21-15/h1-6,9,16H,7-8,10H2 |
| InChIKey | JWOSWLVZLSXNTP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |