C15H20O3 — CID 62799391
(4-butan-2-ylphenyl)-(1,4-dioxan-2-yl)methanone (PubChem CID 62799391) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (4-butan-2-ylphenyl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 62799391 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4-butan-2-ylphenyl)-(1,4-dioxan-2-yl)methanone |
| SMILES | CCC(C)c1ccc(C(=O)C2COCCO2)cc1 |
| InChI | InChI=1S/C15H20O3/c1-3-11(2)12-4-6-13(7-5-12)15(16)14-10-17-8-9-18-14/h4-7,11,14H,3,8-10H2,1-2H3 |
| InChIKey | LJOYUJWABCRDCZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |