C17H15NO3 — CID 7269123
(2R)-N-dibenzofuran-3-yloxolane-2-carboxamide (PubChem CID 7269123) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2R)-N-dibenzofuran-3-yloxolane-2-carboxamide.
| Compound Name | (2R)-N-dibenzofuran-3-yloxolane-2-carboxamide |
|---|---|
| PubChem CID | 7269123 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2R)-N-dibenzofuran-3-yloxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)[C@H]1CCCO1 |
| InChI | InChI=1S/C17H15NO3/c19-17(15-6-3-9-20-15)18-11-7-8-13-12-4-1-2-5-14(12)21-16(13)10-11/h1-2,4-5,7-8,10,15H,3,6,9H2,(H,18,19)/t15-/m1/s1 |
| InChIKey | NRFLMXDTABSKGN-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |