C17H24IO2S+ — CID 171722815
1-(4-iodo-2-methylphenyl)-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one (PubChem CID 171722815) has the molecular formula C17H24IO2S+ and a molecular weight of 419.35 g/mol. Its IUPAC name is 1-(4-iodo-2-methylphenyl)-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one.
| Compound Name | 1-(4-iodo-2-methylphenyl)-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
|---|---|
| PubChem CID | 171722815 |
| Molecular Formula | C17H24IO2S+ |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(4-iodo-2-methylphenyl)-3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)butan-1-one |
| SMILES | Cc1cc(I)ccc1C(=O)C([S+]1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C17H24IO2S/c1-12-11-13(18)5-6-14(12)15(19)16(17(2,3)4)21-9-7-20-8-10-21/h5-6,11,16H,7-10H2,1-4H3/q+1 |
| InChIKey | XHCUAPRDERVRHR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|