C24H31O3S+ — CID 140692105
1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-2-(thiolan-1-ium-1-yl)butan-1-one (PubChem CID 140692105) has the molecular formula C24H31O3S+ and a molecular weight of 399.58 g/mol. Its IUPAC name is 1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-2-(thiolan-1-ium-1-yl)butan-1-one.
| Compound Name | 1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-2-(thiolan-1-ium-1-yl)butan-1-one |
|---|---|
| PubChem CID | 140692105 |
| Molecular Formula | C24H31O3S+ |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-2-(thiolan-1-ium-1-yl)butan-1-one |
| SMILES | CCOc1ccc(Oc2ccc(C(=O)C([S+]3CCCC3)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H31O3S/c1-5-26-19-12-14-21(15-13-19)27-20-10-8-18(9-11-20)22(25)23(24(2,3)4)28-16-6-7-17-28/h8-15,23H,5-7,16-17H2,1-4H3/q+1 |
| InChIKey | SYMGMYNJDDTFQB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|