C24H33O3S+ — CID 140692066
[1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-1-oxobutan-2-yl]-diethylsulfanium (PubChem CID 140692066) has the molecular formula C24H33O3S+ and a molecular weight of 401.59 g/mol. Its IUPAC name is [1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-1-oxobutan-2-yl]-diethylsulfanium.
| Compound Name | [1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-1-oxobutan-2-yl]-diethylsulfanium |
|---|---|
| PubChem CID | 140692066 |
| Molecular Formula | C24H33O3S+ |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [1-[4-(4-ethoxyphenoxy)phenyl]-3,3-dimethyl-1-oxobutan-2-yl]-diethylsulfanium |
| SMILES | CCOc1ccc(Oc2ccc(C(=O)C([S+](CC)CC)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33O3S/c1-7-26-19-14-16-21(17-15-19)27-20-12-10-18(11-13-20)22(25)23(24(4,5)6)28(8-2)9-3/h10-17,23H,7-9H2,1-6H3/q+1 |
| InChIKey | PRGUDPPESCWNRC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|