C34H54Cl2N2O4 — CID 44658399
[7-[(diethylazaniumyl)methyl]-2-(4-ethoxybenzoyl)-8-(4-ethoxyphenyl)-8-oxooctyl]-diethylazanium dichloride (PubChem CID 44658399) has the molecular formula C34H54Cl2N2O4 and a molecular weight of 625.72 g/mol. Its IUPAC name is [7-[(diethylazaniumyl)methyl]-2-(4-ethoxybenzoyl)-8-(4-ethoxyphenyl)-8-oxooctyl]-diethylazanium dichloride.
| Compound Name | [7-[(diethylazaniumyl)methyl]-2-(4-ethoxybenzoyl)-8-(4-ethoxyphenyl)-8-oxooctyl]-diethylazanium dichloride |
|---|---|
| PubChem CID | 44658399 |
| Molecular Formula | C34H54Cl2N2O4 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | [7-[(diethylazaniumyl)methyl]-2-(4-ethoxybenzoyl)-8-(4-ethoxyphenyl)-8-oxooctyl]-diethylazanium dichloride |
| SMILES | CCOc1ccc(C(=O)C(CCCCC(C[NH+](CC)CC)C(=O)c2ccc(OCC)cc2)C[NH+](CC)CC)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C34H52N2O4.2ClH/c1-7-35(8-2)25-29(33(37)27-17-21-31(22-18-27)39-11-5)15-13-14-16-30(26-36(9-3)10-4)34(38)28-19-23-32(24-20-28)40-12-6;;/h17-24,29-30H,7-16,25-26H2,1-6H3;2*1H |
| InChIKey | PPVBWOUHJAXQTP-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 61.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|