C32H48N2O4 — CID 3094843
2,5-bis(diethylaminomethyl)-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione (PubChem CID 3094843) has the molecular formula C32H48N2O4 and a molecular weight of 524.75 g/mol. Its IUPAC name is 2,5-bis(diethylaminomethyl)-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione.
| Compound Name | 2,5-bis(diethylaminomethyl)-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 3094843 |
| Molecular Formula | C32H48N2O4 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | 2,5-bis(diethylaminomethyl)-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione |
| SMILES | CCOc1ccc(C(=O)C(CCC(CN(CC)CC)C(=O)c2ccc(OCC)cc2)CN(CC)CC)cc1 |
| InChI | InChI=1S/C32H48N2O4/c1-7-33(8-2)23-27(31(35)25-15-19-29(20-16-25)37-11-5)13-14-28(24-34(9-3)10-4)32(36)26-17-21-30(22-18-26)38-12-6/h15-22,27-28H,7-14,23-24H2,1-6H3 |
| InChIKey | ASTADIVAIXQGGP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |