C26H36N2O4 — CID 40877312
(2S,5S)-2,5-bis[(dimethylamino)methyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione (PubChem CID 40877312) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (2S,5S)-2,5-bis[(dimethylamino)methyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione.
| Compound Name | (2S,5S)-2,5-bis[(dimethylamino)methyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 40877312 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (2S,5S)-2,5-bis[(dimethylamino)methyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione |
| SMILES | COc1ccc(C(=O)[C@@H](CC[C@@H](CN(C)C)C(=O)c2ccc(OC)cc2)CN(C)C)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-27(2)17-21(25(29)19-9-13-23(31-5)14-10-19)7-8-22(18-28(3)4)26(30)20-11-15-24(32-6)16-12-20/h9-16,21-22H,7-8,17-18H2,1-6H3/t21-,22-/m0/s1 |
| InChIKey | UTLTYRQDCPGJCP-VXKWHMMOSA-N |
| XLogP | 3.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |