C32H46N2O4+2 — CID 3913349
1,6-bis(4-methoxyphenyl)-2,5-bis(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione (PubChem CID 3913349) has the molecular formula C32H46N2O4+2 and a molecular weight of 522.73 g/mol. Its IUPAC name is 1,6-bis(4-methoxyphenyl)-2,5-bis(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione.
| Compound Name | 1,6-bis(4-methoxyphenyl)-2,5-bis(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 3913349 |
| Molecular Formula | C32H46N2O4+2 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | 1,6-bis(4-methoxyphenyl)-2,5-bis(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione |
| SMILES | COc1ccc(C(=O)C(CCC(C[NH+]2CCCCC2)C(=O)c2ccc(OC)cc2)C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C32H44N2O4/c1-37-29-15-11-25(12-16-29)31(35)27(23-33-19-5-3-6-20-33)9-10-28(24-34-21-7-4-8-22-34)32(36)26-13-17-30(38-2)18-14-26/h11-18,27-28H,3-10,19-24H2,1-2H3/p+2 |
| InChIKey | WUCCTPWXHXLLMT-UHFFFAOYSA-P |
| XLogP | 2.92 |
| TPSA | 61.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |