C32H46Cl2N2O4 — CID 44657498
1,8-bis(4-methoxyphenyl)-2,7-di(piperidin-1-ium-1-yl)octane-1,8-dione dichloride (PubChem CID 44657498) has the molecular formula C32H46Cl2N2O4 and a molecular weight of 593.64 g/mol. Its IUPAC name is 1,8-bis(4-methoxyphenyl)-2,7-di(piperidin-1-ium-1-yl)octane-1,8-dione dichloride.
| Compound Name | 1,8-bis(4-methoxyphenyl)-2,7-di(piperidin-1-ium-1-yl)octane-1,8-dione dichloride |
|---|---|
| PubChem CID | 44657498 |
| Molecular Formula | C32H46Cl2N2O4 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 1,8-bis(4-methoxyphenyl)-2,7-di(piperidin-1-ium-1-yl)octane-1,8-dione dichloride |
| SMILES | COc1ccc(C(=O)C(CCCCC(C(=O)c2ccc(OC)cc2)[NH+]2CCCCC2)[NH+]2CCCCC2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C32H44N2O4.2ClH/c1-37-27-17-13-25(14-18-27)31(35)29(33-21-7-3-8-22-33)11-5-6-12-30(34-23-9-4-10-24-34)32(36)26-15-19-28(38-2)20-16-26;;/h13-20,29-30H,3-12,21-24H2,1-2H3;2*1H |
| InChIKey | SZXLAPPVUOSUDJ-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 61.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|