C11H21O2S+ — CID 140741719
4,4-dimethyl-3-(1,4-oxathian-4-ium-4-yl)pentan-2-one (PubChem CID 140741719) has the molecular formula C11H21O2S+ and a molecular weight of 217.35 g/mol. Its IUPAC name is 4,4-dimethyl-3-(1,4-oxathian-4-ium-4-yl)pentan-2-one.
| Compound Name | 4,4-dimethyl-3-(1,4-oxathian-4-ium-4-yl)pentan-2-one |
|---|---|
| PubChem CID | 140741719 |
| Molecular Formula | C11H21O2S+ |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4,4-dimethyl-3-(1,4-oxathian-4-ium-4-yl)pentan-2-one |
| SMILES | CC(=O)C([S+]1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C11H21O2S/c1-9(12)10(11(2,3)4)14-7-5-13-6-8-14/h10H,5-8H2,1-4H3/q+1 |
| InChIKey | JWKUGRKZUVWEHT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|