C16H18F3NO5S2 — CID 174576553
[4-[1-(benzenesulfonamido)ethyl]phenyl] trifluoromethanesulfonate;methane (PubChem CID 174576553) has the molecular formula C16H18F3NO5S2 and a molecular weight of 425.45 g/mol. Its IUPAC name is [4-[1-(benzenesulfonamido)ethyl]phenyl] trifluoromethanesulfonate;methane.
| Compound Name | [4-[1-(benzenesulfonamido)ethyl]phenyl] trifluoromethanesulfonate;methane |
|---|---|
| PubChem CID | 174576553 |
| Molecular Formula | C16H18F3NO5S2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [4-[1-(benzenesulfonamido)ethyl]phenyl] trifluoromethanesulfonate;methane |
| SMILES | C.CC(NS(=O)(=O)c1ccccc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3NO5S2.CH4/c1-11(19-25(20,21)14-5-3-2-4-6-14)12-7-9-13(10-8-12)24-26(22,23)15(16,17)18;/h2-11,19H,1H3;1H4 |
| InChIKey | YCTVDSIBBFELMS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|