C18H21F3N2O5S2 — CID 175258354
methane;[4-[1-(3-pyridin-3-ylprop-2-enylsulfonylamino)ethyl]phenyl] trifluoromethanesulfonate (PubChem CID 175258354) has the molecular formula C18H21F3N2O5S2 and a molecular weight of 466.50 g/mol. Its IUPAC name is methane;[4-[1-(3-pyridin-3-ylprop-2-enylsulfonylamino)ethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | methane;[4-[1-(3-pyridin-3-ylprop-2-enylsulfonylamino)ethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175258354 |
| Molecular Formula | C18H21F3N2O5S2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | methane;[4-[1-(3-pyridin-3-ylprop-2-enylsulfonylamino)ethyl]phenyl] trifluoromethanesulfonate |
| SMILES | C.CC(NS(=O)(=O)CC=Cc1cccnc1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O5S2.CH4/c1-13(22-28(23,24)11-3-5-14-4-2-10-21-12-14)15-6-8-16(9-7-15)27-29(25,26)17(18,19)20;/h2-10,12-13,22H,11H2,1H3;1H4 |
| InChIKey | OCPHOPZQRPDCGJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|