C14H10F3NO6S2 — CID 155170716
[4-(trifluoromethylsulfonylcarbamoyl)phenyl] benzenesulfonate (PubChem CID 155170716) has the molecular formula C14H10F3NO6S2 and a molecular weight of 409.36 g/mol. Its IUPAC name is [4-(trifluoromethylsulfonylcarbamoyl)phenyl] benzenesulfonate.
| Compound Name | [4-(trifluoromethylsulfonylcarbamoyl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 155170716 |
| Molecular Formula | C14H10F3NO6S2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | [4-(trifluoromethylsulfonylcarbamoyl)phenyl] benzenesulfonate |
| SMILES | O=C(NS(=O)(=O)C(F)(F)F)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H10F3NO6S2/c15-14(16,17)26(22,23)18-13(19)10-6-8-11(9-7-10)24-25(20,21)12-4-2-1-3-5-12/h1-9H,(H,18,19) |
| InChIKey | WCMPLWULKCSLRB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|