C20H21NO6S — CID 177392529
2-[4-(2-oxopyrrolidine-1-carbonyl)phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 177392529) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[4-(2-oxopyrrolidine-1-carbonyl)phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-(2-oxopyrrolidine-1-carbonyl)phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 177392529 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[4-(2-oxopyrrolidine-1-carbonyl)phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(C(=O)N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C20H21NO6S/c1-15-4-10-18(11-5-15)28(24,25)27-14-13-26-17-8-6-16(7-9-17)20(23)21-12-2-3-19(21)22/h4-11H,2-3,12-14H2,1H3 |
| InChIKey | RUANFFIDVVGXQX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|