C10H16N2O8S2 — CID 54391670
2-[4-(2-sulfamoyloxyethoxy)phenoxy]ethyl sulfamate (PubChem CID 54391670) has the molecular formula C10H16N2O8S2 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[4-(2-sulfamoyloxyethoxy)phenoxy]ethyl sulfamate.
| Compound Name | 2-[4-(2-sulfamoyloxyethoxy)phenoxy]ethyl sulfamate |
|---|---|
| PubChem CID | 54391670 |
| Molecular Formula | C10H16N2O8S2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-[4-(2-sulfamoyloxyethoxy)phenoxy]ethyl sulfamate |
| SMILES | NS(=O)(=O)OCCOc1ccc(OCCOS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H16N2O8S2/c11-21(13,14)19-7-5-17-9-1-2-10(4-3-9)18-6-8-20-22(12,15)16/h1-4H,5-8H2,(H2,11,13,14)(H2,12,15,16) |
| InChIKey | VHBFOUFNQLIOHO-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|