C9H10Cl2O4S — CID 150853890
2-(3,4-dichlorophenoxy)ethyl methanesulfonate (PubChem CID 150853890) has the molecular formula C9H10Cl2O4S and a molecular weight of 285.15 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)ethyl methanesulfonate.
| Compound Name | 2-(3,4-dichlorophenoxy)ethyl methanesulfonate |
|---|---|
| PubChem CID | 150853890 |
| Molecular Formula | C9H10Cl2O4S |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O4S/c1-16(12,13)15-5-4-14-7-2-3-8(10)9(11)6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | KQPCXBZNMSVNHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|