C21H17ClN2O4S — CID 86601139
2-[4-[2-[5-(4-chlorophenyl)pyrazin-2-yl]ethynyl]phenoxy]ethyl methanesulfonate (PubChem CID 86601139) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 2-[4-[2-[5-(4-chlorophenyl)pyrazin-2-yl]ethynyl]phenoxy]ethyl methanesulfonate.
| Compound Name | 2-[4-[2-[5-(4-chlorophenyl)pyrazin-2-yl]ethynyl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 86601139 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2-[4-[2-[5-(4-chlorophenyl)pyrazin-2-yl]ethynyl]phenoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1ccc(C#Cc2cnc(-c3ccc(Cl)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H17ClN2O4S/c1-29(25,26)28-13-12-27-20-10-3-16(4-11-20)2-9-19-14-24-21(15-23-19)17-5-7-18(22)8-6-17/h3-8,10-11,14-15H,12-13H2,1H3 |
| InChIKey | MLSJTYQFWPFQDE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|