C28H24ClF3N2O2 — CID 11497172
1-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]-2,2,2-trifluoroethanone (PubChem CID 11497172) has the molecular formula C28H24ClF3N2O2 and a molecular weight of 512.96 g/mol. Its IUPAC name is 1-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 11497172 |
| Molecular Formula | C28H24ClF3N2O2 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 1-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(C1CCN(CCOc2ccc(C#Cc3ccc(-c4ccc(Cl)cc4)cn3)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C28H24ClF3N2O2/c29-24-7-4-21(5-8-24)23-6-10-25(33-19-23)9-1-20-2-11-26(12-3-20)36-18-17-34-15-13-22(14-16-34)27(35)28(30,31)32/h2-8,10-12,19,22H,13-18H2 |
| InChIKey | PYBUZVREHOQEAG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|