C32H31ClN4O — CID 59835756
N-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]ethyl]piperidin-4-yl]pyridin-2-amine (PubChem CID 59835756) has the molecular formula C32H31ClN4O and a molecular weight of 523.08 g/mol. Its IUPAC name is N-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]ethyl]piperidin-4-yl]pyridin-2-amine.
| Compound Name | N-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]ethyl]piperidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 59835756 |
| Molecular Formula | C32H31ClN4O |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]ethyl]piperidin-4-yl]pyridin-2-amine |
| SMILES | Cc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCN1CCC(Nc2ccccn2)CC1 |
| InChI | InChI=1S/C32H31ClN4O/c1-24-22-25(5-12-29-13-9-27(23-35-29)26-7-10-28(33)11-8-26)6-14-31(24)38-21-20-37-18-15-30(16-19-37)36-32-4-2-3-17-34-32/h2-4,6-11,13-14,17,22-23,30H,15-16,18-21H2,1H3,(H,34,36) |
| InChIKey | LXGUIXPKFAOELF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|