C32H35ClN2O — CID 69057529
3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclohexyl-1-cyclopropylpropan-1-amine (PubChem CID 69057529) has the molecular formula C32H35ClN2O and a molecular weight of 499.10 g/mol. Its IUPAC name is 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclohexyl-1-cyclopropylpropan-1-amine.
| Compound Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclohexyl-1-cyclopropylpropan-1-amine |
|---|---|
| PubChem CID | 69057529 |
| Molecular Formula | C32H35ClN2O |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]-1-cyclohexyl-1-cyclopropylpropan-1-amine |
| SMILES | Cc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCC(N)(C1CCCCC1)C1CC1 |
| InChI | InChI=1S/C32H35ClN2O/c1-23-21-24(7-16-30-17-11-26(22-35-30)25-9-14-29(33)15-10-25)8-18-31(23)36-20-19-32(34,28-12-13-28)27-5-3-2-4-6-27/h8-11,14-15,17-18,21-22,27-28H,2-6,12-13,19-20,34H2,1H3 |
| InChIKey | INIJFQDFNLTQHC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|