C30H27ClN2O2 — CID 142782368
4-[[3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]propylamino]methyl]phenol (PubChem CID 142782368) has the molecular formula C30H27ClN2O2 and a molecular weight of 483.01 g/mol. Its IUPAC name is 4-[[3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]propylamino]methyl]phenol.
| Compound Name | 4-[[3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]propylamino]methyl]phenol |
|---|---|
| PubChem CID | 142782368 |
| Molecular Formula | C30H27ClN2O2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[[3-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-methylphenoxy]propylamino]methyl]phenol |
| SMILES | Cc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCCNCc1ccc(O)cc1 |
| InChI | InChI=1S/C30H27ClN2O2/c1-22-19-23(3-12-28-13-9-26(21-33-28)25-7-10-27(31)11-8-25)6-16-30(22)35-18-2-17-32-20-24-4-14-29(34)15-5-24/h4-11,13-16,19,21,32,34H,2,17-18,20H2,1H3 |
| InChIKey | HACZEEFKOVLKCI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|