C21H16ClNO — CID 69057844
2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]ethanol (PubChem CID 69057844) has the molecular formula C21H16ClNO and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]ethanol.
| Compound Name | 2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]ethanol |
|---|---|
| PubChem CID | 69057844 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenyl]ethanol |
| SMILES | OCCc1ccc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H16ClNO/c22-20-9-6-18(7-10-20)19-8-12-21(23-15-19)11-5-16-1-3-17(4-2-16)13-14-24/h1-4,6-10,12,15,24H,13-14H2 |
| InChIKey | SSNVJDMMYKOICF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|