C27H24ClF3N2O2 — CID 11504274
1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-(trifluoromethyl)piperidin-4-ol (PubChem CID 11504274) has the molecular formula C27H24ClF3N2O2 and a molecular weight of 500.95 g/mol. Its IUPAC name is 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-(trifluoromethyl)piperidin-4-ol.
| Compound Name | 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 11504274 |
| Molecular Formula | C27H24ClF3N2O2 |
| Molecular Weight | 500.95 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-(trifluoromethyl)piperidin-4-ol |
| SMILES | OC1(C(F)(F)F)CCN(CCOc2ccc(C#Cc3ccc(-c4ccc(Cl)cc4)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H24ClF3N2O2/c28-23-7-4-21(5-8-23)22-6-10-24(32-19-22)9-1-20-2-11-25(12-3-20)35-18-17-33-15-13-26(34,14-16-33)27(29,30)31/h2-8,10-12,19,34H,13-18H2 |
| InChIKey | VNXUKSFLBZQILZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|