C36H42ClN3O3 — CID 142675268
butyl 4-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 142675268) has the molecular formula C36H42ClN3O3 and a molecular weight of 600.20 g/mol. Its IUPAC name is butyl 4-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142675268 |
| Molecular Formula | C36H42ClN3O3 |
| Molecular Weight | 600.20 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | butyl 4-[1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(C2CCN(CCOc3ccc(C#Cc4ccc(-c5ccc(Cl)cc5)cn4)cc3)CC2)CC1 |
| InChI | InChI=1S/C36H42ClN3O3/c1-2-3-25-43-36(41)40-22-18-31(19-23-40)30-16-20-39(21-17-30)24-26-42-35-14-5-28(6-15-35)4-12-34-13-9-32(27-38-34)29-7-10-33(37)11-8-29/h5-11,13-15,27,30-31H,2-3,16-26H2,1H3 |
| InChIKey | UFJPTXKRNBOVHQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.20 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|