C34H42N2O — CID 142889888
2-[2-[4-[2-(4-heptan-4-ylpiperidin-1-yl)ethoxy]phenyl]ethynyl]-5-(4-methylphenyl)pyridine (PubChem CID 142889888) has the molecular formula C34H42N2O and a molecular weight of 494.72 g/mol. Its IUPAC name is 2-[2-[4-[2-(4-heptan-4-ylpiperidin-1-yl)ethoxy]phenyl]ethynyl]-5-(4-methylphenyl)pyridine.
| Compound Name | 2-[2-[4-[2-(4-heptan-4-ylpiperidin-1-yl)ethoxy]phenyl]ethynyl]-5-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 142889888 |
| Molecular Formula | C34H42N2O |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 2-[2-[4-[2-(4-heptan-4-ylpiperidin-1-yl)ethoxy]phenyl]ethynyl]-5-(4-methylphenyl)pyridine |
| SMILES | CCCC(CCC)C1CCN(CCOc2ccc(C#Cc3ccc(-c4ccc(C)cc4)cn3)cc2)CC1 |
| InChI | InChI=1S/C34H42N2O/c1-4-6-29(7-5-2)31-20-22-36(23-21-31)24-25-37-34-18-11-28(12-19-34)10-16-33-17-15-32(26-35-33)30-13-8-27(3)9-14-30/h8-9,11-15,17-19,26,29,31H,4-7,20-25H2,1-3H3 |
| InChIKey | TVLYRZWQBHYMQZ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|