C18H19NO — CID 19983985
2-[2-(4-butoxyphenyl)ethynyl]-5-methylpyridine (PubChem CID 19983985) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[2-(4-butoxyphenyl)ethynyl]-5-methylpyridine.
| Compound Name | 2-[2-(4-butoxyphenyl)ethynyl]-5-methylpyridine |
|---|---|
| PubChem CID | 19983985 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[2-(4-butoxyphenyl)ethynyl]-5-methylpyridine |
| SMILES | CCCCOc1ccc(C#Cc2ccc(C)cn2)cc1 |
| InChI | InChI=1S/C18H19NO/c1-3-4-13-20-18-11-7-16(8-12-18)6-10-17-9-5-15(2)14-19-17/h5,7-9,11-12,14H,3-4,13H2,1-2H3 |
| InChIKey | AXIPXUNKMZBIRB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|