C18H19N — CID 19983934
2-[2-(4-butylphenyl)ethynyl]-5-methylpyridine (PubChem CID 19983934) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[2-(4-butylphenyl)ethynyl]-5-methylpyridine.
| Compound Name | 2-[2-(4-butylphenyl)ethynyl]-5-methylpyridine |
|---|---|
| PubChem CID | 19983934 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-[2-(4-butylphenyl)ethynyl]-5-methylpyridine |
| SMILES | CCCCc1ccc(C#Cc2ccc(C)cn2)cc1 |
| InChI | InChI=1S/C18H19N/c1-3-4-5-16-7-9-17(10-8-16)11-13-18-12-6-15(2)14-19-18/h6-10,12,14H,3-5H2,1-2H3 |
| InChIKey | GZTBCLWAEQJKQP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|