C21H23BrN2O — CID 69060172
5-bromo-2-[2-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]ethynyl]pyridine (PubChem CID 69060172) has the molecular formula C21H23BrN2O and a molecular weight of 399.33 g/mol. Its IUPAC name is 5-bromo-2-[2-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]ethynyl]pyridine.
| Compound Name | 5-bromo-2-[2-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 69060172 |
| Molecular Formula | C21H23BrN2O |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 5-bromo-2-[2-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]ethynyl]pyridine |
| SMILES | CC1CCN(CCOc2ccc(C#Cc3ccc(Br)cn3)cc2)CC1 |
| InChI | InChI=1S/C21H23BrN2O/c1-17-10-12-24(13-11-17)14-15-25-21-8-3-18(4-9-21)2-6-20-7-5-19(22)16-23-20/h3-5,7-9,16-17H,10-15H2,1H3 |
| InChIKey | OFWLTUSNVWQNSM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|