C26H24ClN3O2 — CID 90907153
5-(4-chlorophenyl)-2-[2-[3-(nitrosomethyl)-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethynyl]pyridine (PubChem CID 90907153) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[2-[3-(nitrosomethyl)-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethynyl]pyridine.
| Compound Name | 5-(4-chlorophenyl)-2-[2-[3-(nitrosomethyl)-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 90907153 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[2-[3-(nitrosomethyl)-4-(2-pyrrolidin-1-ylethoxy)phenyl]ethynyl]pyridine |
| SMILES | O=NCc1cc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C26H24ClN3O2/c27-24-8-5-21(6-9-24)22-7-11-25(28-18-22)10-3-20-4-12-26(23(17-20)19-29-31)32-16-15-30-13-1-2-14-30/h4-9,11-12,17-18H,1-2,13-16,19H2 |
| InChIKey | ZSSLVSWBTCINLS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|