C28H24ClN3O — CID 10049588
5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-8-(2-pyrrolidin-1-ylethoxy)quinoline (PubChem CID 10049588) has the molecular formula C28H24ClN3O and a molecular weight of 453.97 g/mol. Its IUPAC name is 5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-8-(2-pyrrolidin-1-ylethoxy)quinoline.
| Compound Name | 5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-8-(2-pyrrolidin-1-ylethoxy)quinoline |
|---|---|
| PubChem CID | 10049588 |
| Molecular Formula | C28H24ClN3O |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-8-(2-pyrrolidin-1-ylethoxy)quinoline |
| SMILES | Clc1ccc(-c2ccc(C#Cc3ccc(OCCN4CCCC4)c4ncccc34)nc2)cc1 |
| InChI | InChI=1S/C28H24ClN3O/c29-24-10-5-21(6-11-24)23-8-13-25(31-20-23)12-7-22-9-14-27(28-26(22)4-3-15-30-28)33-19-18-32-16-1-2-17-32/h3-6,8-11,13-15,20H,1-2,16-19H2 |
| InChIKey | YVVDRDVUSNSUTG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|