C27H29ClN2O — CID 163976853
5-(4-chlorophenyl)-2-[2-[3-methyl-4-(2-piperidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]ethynyl]pyridine (PubChem CID 163976853) has the molecular formula C27H29ClN2O and a molecular weight of 433.00 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[2-[3-methyl-4-(2-piperidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]ethynyl]pyridine.
| Compound Name | 5-(4-chlorophenyl)-2-[2-[3-methyl-4-(2-piperidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 163976853 |
| Molecular Formula | C27H29ClN2O |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[2-[3-methyl-4-(2-piperidin-1-ylethoxy)cyclohexa-2,4-dien-1-yl]ethynyl]pyridine |
| SMILES | CC1=CC(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)CC=C1OCCN1CCCCC1 |
| InChI | InChI=1S/C27H29ClN2O/c1-21-19-22(6-14-27(21)31-18-17-30-15-3-2-4-16-30)5-12-26-13-9-24(20-29-26)23-7-10-25(28)11-8-23/h7-11,13-14,19-20,22H,2-4,6,15-18H2,1H3 |
| InChIKey | SUXDDQCKBSETAS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|