C25H24ClN3 — CID 173211366
5-(4-chlorophenyl)-2-[2-[6-(2-piperidin-1-ylethyl)-3-pyridinyl]ethynyl]pyridine (PubChem CID 173211366) has the molecular formula C25H24ClN3 and a molecular weight of 401.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[2-[6-(2-piperidin-1-ylethyl)-3-pyridinyl]ethynyl]pyridine.
| Compound Name | 5-(4-chlorophenyl)-2-[2-[6-(2-piperidin-1-ylethyl)-3-pyridinyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 173211366 |
| Molecular Formula | C25H24ClN3 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[2-[6-(2-piperidin-1-ylethyl)-3-pyridinyl]ethynyl]pyridine |
| SMILES | Clc1ccc(-c2ccc(C#Cc3ccc(CCN4CCCCC4)nc3)nc2)cc1 |
| InChI | InChI=1S/C25H24ClN3/c26-23-9-6-21(7-10-23)22-8-13-24(28-19-22)11-4-20-5-12-25(27-18-20)14-17-29-15-2-1-3-16-29/h5-10,12-13,18-19H,1-3,14-17H2 |
| InChIKey | BLABERHBKCPEMU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|