C28H28ClN3 — CID 72631077
5-(4-chlorophenyl)-2-[2-[6-[3-(4,4-dimethylpiperidin-1-yl)prop-1-enyl]-3-pyridinyl]ethynyl]pyridine (PubChem CID 72631077) has the molecular formula C28H28ClN3 and a molecular weight of 442.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[2-[6-[3-(4,4-dimethylpiperidin-1-yl)prop-1-enyl]-3-pyridinyl]ethynyl]pyridine.
| Compound Name | 5-(4-chlorophenyl)-2-[2-[6-[3-(4,4-dimethylpiperidin-1-yl)prop-1-enyl]-3-pyridinyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 72631077 |
| Molecular Formula | C28H28ClN3 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[2-[6-[3-(4,4-dimethylpiperidin-1-yl)prop-1-enyl]-3-pyridinyl]ethynyl]pyridine |
| SMILES | CC1(C)CCN(CC=Cc2ccc(C#Cc3ccc(-c4ccc(Cl)cc4)cn3)cn2)CC1 |
| InChI | InChI=1S/C28H28ClN3/c1-28(2)15-18-32(19-16-28)17-3-4-26-12-5-22(20-30-26)6-13-27-14-9-24(21-31-27)23-7-10-25(29)11-8-23/h3-5,7-12,14,20-21H,15-19H2,1-2H3 |
| InChIKey | CNKGGFBOSNXXTG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|