About Desloratadine
Desloratadine (PubChem CID 124087) has the molecular formula C19H19ClN2
and a molecular weight of 310.80 g/mol. Its IUPAC name is 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
Molecular Properties
| Compound Name | Desloratadine |
| PubChem CID | 124087 |
| Molecular Formula | C19H19ClN2 |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCNCC3)C4=C1C=CC=N4 |
| InChI | InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
| InChIKey | JAUOIFJMECXRGI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | 425 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Desloratadine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Desloratadine?
The IUPAC name of Desloratadine (CID 124087) is 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
What is the SMILES notation for Desloratadine?
The canonical SMILES for Desloratadine is C1CC2=C(C=CC(=C2)Cl)C(=C3CCNCC3)C4=C1C=CC=N4.
What is the InChIKey of Desloratadine?
The InChIKey is JAUOIFJMECXRGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2.
What are the key properties of Desloratadine?
Desloratadine has a molecular weight of 310.80 g/mol, XLogP of 4.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Desloratadine is sourced from PubChem (CID 124087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).