C26H26ClN3 — CID 133017
Rupatadine (PubChem CID 133017) has the molecular formula C26H26ClN3 and a molecular weight of 416.00 g/mol. Its IUPAC name is 13-chloro-2-[1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | Rupatadine |
|---|---|
| PubChem CID | 133017 |
| Molecular Formula | C26H26ClN3 |
| Molecular Weight | 416.00 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 13-chloro-2-[1-[(5-methyl-3-pyridinyl)methyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | CC1=CC(=CN=C1)CN2CCC(=C3C4=C(CCC5=C3N=CC=C5)C=C(C=C4)Cl)CC2 |
| InChI | InChI=1S/C26H26ClN3/c1-18-13-19(16-28-15-18)17-30-11-8-20(9-12-30)25-24-7-6-23(27)14-22(24)5-4-21-3-2-10-29-26(21)25/h2-3,6-7,10,13-16H,4-5,8-9,11-12,17H2,1H3 |
| InChIKey | WUZYKBABMWJHDL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | 609 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |