C24H23ClN4 — CID 142782367
1-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-pyridinyl]-2-pyrrolidin-1-ylethanamine (PubChem CID 142782367) has the molecular formula C24H23ClN4 and a molecular weight of 402.93 g/mol. Its IUPAC name is 1-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-pyridinyl]-2-pyrrolidin-1-ylethanamine.
| Compound Name | 1-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-pyridinyl]-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 142782367 |
| Molecular Formula | C24H23ClN4 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[5-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-2-pyridinyl]-2-pyrrolidin-1-ylethanamine |
| SMILES | NC(CN1CCCC1)c1ccc(C#Cc2ccc(-c3ccc(Cl)cc3)cn2)cn1 |
| InChI | InChI=1S/C24H23ClN4/c25-21-8-5-19(6-9-21)20-7-11-22(27-16-20)10-3-18-4-12-24(28-15-18)23(26)17-29-13-1-2-14-29/h4-9,11-12,15-16,23H,1-2,13-14,17,26H2 |
| InChIKey | RDXJZFDYPDWFSB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|